C8H19NO7 — CID 90384745
8-aminooctane-1,1,1,2,2,3,3-heptol (PubChem CID 90384745) has the molecular formula C8H19NO7 and a molecular weight of 241.24 g/mol. Its IUPAC name is 8-aminooctane-1,1,1,2,2,3,3-heptol.
| Compound Name | 8-aminooctane-1,1,1,2,2,3,3-heptol |
|---|---|
| PubChem CID | 90384745 |
| Molecular Formula | C8H19NO7 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 8-aminooctane-1,1,1,2,2,3,3-heptol |
| SMILES | NCCCCCC(O)(O)C(O)(O)C(O)(O)O |
| InChI | InChI=1S/C8H19NO7/c9-5-3-1-2-4-6(10,11)7(12,13)8(14,15)16/h10-16H,1-5,9H2 |
| InChIKey | LMUNOEALBNORIR-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 167.63 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|