C25H30BrNO4 — CID 90384791
(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[(5-bromo-2-hydroxyphenyl)methylamino]-2-methoxybenzoate (PubChem CID 90384791) has the molecular formula C25H30BrNO4 and a molecular weight of 488.42 g/mol. Its IUPAC name is (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[(5-bromo-2-hydroxyphenyl)methylamino]-2-methoxybenzoate.
| Compound Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[(5-bromo-2-hydroxyphenyl)methylamino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 90384791 |
| Molecular Formula | C25H30BrNO4 |
| Molecular Weight | 488.42 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl) 4-[(5-bromo-2-hydroxyphenyl)methylamino]-2-methoxybenzoate |
| SMILES | COc1cc(NCc2cc(Br)ccc2O)ccc1C(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C25H30BrNO4/c1-24(2)16-9-10-25(24,3)22(12-16)31-23(29)19-7-6-18(13-21(19)30-4)27-14-15-11-17(26)5-8-20(15)28/h5-8,11,13,16,22,27-28H,9-10,12,14H2,1-4H3 |
| InChIKey | CBGFKEPLCDUBOU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|