C36H39NO2 — CID 90384844
tert-butyl 4-benzhydryl-2-(2,2-diphenylethyl)pyrrolidine-1-carboxylate (PubChem CID 90384844) has the molecular formula C36H39NO2 and a molecular weight of 517.71 g/mol. Its IUPAC name is tert-butyl 4-benzhydryl-2-(2,2-diphenylethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-benzhydryl-2-(2,2-diphenylethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90384844 |
| Molecular Formula | C36H39NO2 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.30 |
| IUPAC Name | tert-butyl 4-benzhydryl-2-(2,2-diphenylethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(c2ccccc2)c2ccccc2)CC1CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H39NO2/c1-36(2,3)39-35(38)37-26-31(34(29-20-12-6-13-21-29)30-22-14-7-15-23-30)24-32(37)25-33(27-16-8-4-9-17-27)28-18-10-5-11-19-28/h4-23,31-34H,24-26H2,1-3H3 |
| InChIKey | YYGINRBZUBVIJX-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |