About [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate
[3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 90385049) has the molecular formula C27H25NO5
and a molecular weight of 443.50 g/mol. Its IUPAC name is [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 90385049 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(OC(=O)[C@@H]1CCCN1)c1cccc(COc2ccc(-c3cccc4c3OCC4)cc2)c1 |
| InChI | InChI=1S/C27H25NO5/c29-26(33-27(30)24-8-3-14-28-24)21-6-1-4-18(16-21)17-32-22-11-9-19(10-12-22)23-7-2-5-20-13-15-31-25(20)23/h1-2,4-7,9-12,16,24,28H,3,8,13-15,17H2/t24-/m0/s1 |
| InChIKey | RQDXFHYLQHAQSR-DEOSSOPVSA-N |
| XLogP | 4.30 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate (CID 90385049) is [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate is O=C(OC(=O)[C@@H]1CCCN1)c1cccc(COc2ccc(-c3cccc4c3OCC4)cc2)c1.
What is the InChIKey of [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate?
The InChIKey is RQDXFHYLQHAQSR-DEOSSOPVSA-N. The full InChI is InChI=1S/C27H25NO5/c29-26(33-27(30)24-8-3-14-28-24)21-6-1-4-18(16-21)17-32-22-11-9-19(10-12-22)23-7-2-5-20-13-15-31-25(20)23/h1-2,4-7,9-12,16,24,28H,3,8,13-15,17H2/t24-/m0/s1.
What are the key properties of [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate?
[3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate has a molecular weight of 443.50 g/mol, XLogP of 4.30, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[4-(2,3-dihydro-1-benzofuran-7-yl)phenoxy]methyl]benzoyl] (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 90385049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).