C19H23N3O — CID 90385228
(3Z)-3-[(Z)-prop-1-enyl]-N-[(2E,4E)-5-(1H-pyrazol-4-yl)hepta-2,4,6-trien-2-yl]hexa-3,5-dienamide (PubChem CID 90385228) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (3Z)-3-[(Z)-prop-1-enyl]-N-[(2E,4E)-5-(1H-pyrazol-4-yl)hepta-2,4,6-trien-2-yl]hexa-3,5-dienamide.
| Compound Name | (3Z)-3-[(Z)-prop-1-enyl]-N-[(2E,4E)-5-(1H-pyrazol-4-yl)hepta-2,4,6-trien-2-yl]hexa-3,5-dienamide |
|---|---|
| PubChem CID | 90385228 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (3Z)-3-[(Z)-prop-1-enyl]-N-[(2E,4E)-5-(1H-pyrazol-4-yl)hepta-2,4,6-trien-2-yl]hexa-3,5-dienamide |
| SMILES | C=C/C=C(\C=C/C)CC(=O)N/C(C)=C/C=C(\C=C)c1cn[nH]c1 |
| InChI | InChI=1S/C19H23N3O/c1-5-8-16(9-6-2)12-19(23)22-15(4)10-11-17(7-3)18-13-20-21-14-18/h5-11,13-14H,1,3,12H2,2,4H3,(H,20,21)(H,22,23)/b9-6-,15-10+,16-8+,17-11+ |
| InChIKey | UHFJCGFDVSZJBS-IFJRDTEBSA-N |
| XLogP | 4.08 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|