About 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene
8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene (PubChem CID 90385632) has the molecular formula C7H8N2
and a molecular weight of 120.15 g/mol. Its IUPAC name is 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene.
Molecular Properties
| Compound Name | 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene |
| PubChem CID | 90385632 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene |
| SMILES | c1nn2c3c1CCCC32 |
| InChI | InChI=1S/C7H8N2/c1-2-5-4-8-9-6(3-1)7(5)9/h4,6H,1-3H2 |
| InChIKey | DYUMXXSASTYJRX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene?
The IUPAC name of 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene (CID 90385632) is 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene.
What is the SMILES notation for 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene?
The canonical SMILES for 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene is c1nn2c3c1CCCC32.
What is the InChIKey of 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene?
The InChIKey is DYUMXXSASTYJRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2/c1-2-5-4-8-9-6(3-1)7(5)9/h4,6H,1-3H2.
What are the key properties of 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene?
8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene has a molecular weight of 120.15 g/mol, XLogP of 1.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-diazatricyclo[4.3.0.02,9]nona-1(6),7-diene is sourced from PubChem (CID 90385632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).