About (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate
(3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate (PubChem CID 90385679) has the molecular formula C11H8F3NO4S
and a molecular weight of 307.25 g/mol. Its IUPAC name is (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate |
| PubChem CID | 90385679 |
| Molecular Formula | C11H8F3NO4S |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate |
| SMILES | O=C1NC2(CC2)c2ccc(OS(=O)(=O)C(F)(F)F)cc21 |
| InChI | InChI=1S/C11H8F3NO4S/c12-11(13,14)20(17,18)19-6-1-2-8-7(5-6)9(16)15-10(8)3-4-10/h1-2,5H,3-4H2,(H,15,16) |
| InChIKey | ROSIBXFWDNARHY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate?
The IUPAC name of (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate (CID 90385679) is (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate.
What is the SMILES notation for (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate?
The canonical SMILES for (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate is O=C1NC2(CC2)c2ccc(OS(=O)(=O)C(F)(F)F)cc21.
What is the InChIKey of (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate?
The InChIKey is ROSIBXFWDNARHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F3NO4S/c12-11(13,14)20(17,18)19-6-1-2-8-7(5-6)9(16)15-10(8)3-4-10/h1-2,5H,3-4H2,(H,15,16).
What are the key properties of (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate?
(3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate has a molecular weight of 307.25 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxospiro[2H-isoindole-1,1'-cyclopropane]-5-yl) trifluoromethanesulfonate is sourced from PubChem (CID 90385679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).