(2R)-2-cyanohexanoyl chloride

C7H10ClNO — CID 90385691

IUPAC(2R)-2-cyanohexanoyl chloride
SMILESCCCC[C@H](C#N)C(=O)Cl
InChIInChI=1S/C7H10ClNO/c1-2-3-4-6(5-9)7(8)10/h6H,2-4H2,1H3/t6-/m1/s1
InChIKeyGDNUDXKWHBVRHZ-ZCFIWIBFSA-N
MW159.62 g/mol
LogP2.08
Rot. Bonds4

About (2R)-2-cyanohexanoyl chloride

(2R)-2-cyanohexanoyl chloride (PubChem CID 90385691) has the molecular formula C7H10ClNO and a molecular weight of 159.62 g/mol. Its IUPAC name is (2R)-2-cyanohexanoyl chloride.

Molecular Properties

Compound Name(2R)-2-cyanohexanoyl chloride
PubChem CID90385691
Molecular FormulaC7H10ClNO
Molecular Weight159.62 g/mol
Exact Mass159.05
IUPAC Name(2R)-2-cyanohexanoyl chloride
SMILESCCCC[C@H](C#N)C(=O)Cl
InChIInChI=1S/C7H10ClNO/c1-2-3-4-6(5-9)7(8)10/h6H,2-4H2,1H3/t6-/m1/s1
InChIKeyGDNUDXKWHBVRHZ-ZCFIWIBFSA-N
XLogP2.08
TPSA40.86 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.62
LogP ≤ 52.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze (2R)-2-cyanohexanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-cyanohexanoyl chloride?
The IUPAC name of (2R)-2-cyanohexanoyl chloride (CID 90385691) is (2R)-2-cyanohexanoyl chloride.
What is the SMILES notation for (2R)-2-cyanohexanoyl chloride?
The canonical SMILES for (2R)-2-cyanohexanoyl chloride is CCCC[C@H](C#N)C(=O)Cl.
What is the InChIKey of (2R)-2-cyanohexanoyl chloride?
The InChIKey is GDNUDXKWHBVRHZ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H10ClNO/c1-2-3-4-6(5-9)7(8)10/h6H,2-4H2,1H3/t6-/m1/s1.
What are the key properties of (2R)-2-cyanohexanoyl chloride?
(2R)-2-cyanohexanoyl chloride has a molecular weight of 159.62 g/mol, XLogP of 2.08, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-cyanohexanoyl chloride is sourced from PubChem (CID 90385691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).