About 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide
2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide (PubChem CID 90385948) has the molecular formula C12H17N5O5
and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide |
| PubChem CID | 90385948 |
| Molecular Formula | C12H17N5O5 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NCC(=O)NCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17N5O5/c13-5-8(18)15-7-10(20)16-6-9(19)14-3-4-17-11(21)1-2-12(17)22/h1-2H,3-7,13H2,(H,14,19)(H,15,18)(H,16,20) |
| InChIKey | ISGYDLSCCCEJAW-UHFFFAOYSA-N |
| XLogP | -3.78 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | -3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide?
The IUPAC name of 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide (CID 90385948) is 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide.
What is the SMILES notation for 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide?
The canonical SMILES for 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide is NCC(=O)NCC(=O)NCC(=O)NCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide?
The InChIKey is ISGYDLSCCCEJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O5/c13-5-8(18)15-7-10(20)16-6-9(19)14-3-4-17-11(21)1-2-12(17)22/h1-2H,3-7,13H2,(H,14,19)(H,15,18)(H,16,20).
What are the key properties of 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide?
2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide has a molecular weight of 311.30 g/mol, XLogP of -3.78, 8 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[2-[[2-[2-(2,5-dioxopyrrol-1-yl)ethylamino]-2-oxoethyl]amino]-2-oxoethyl]acetamide is sourced from PubChem (CID 90385948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).