C29H27N5O2 — CID 90386097
N-benzyl-2-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-pyridinyl]-5-phenylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 90386097) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-benzyl-2-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-pyridinyl]-5-phenylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | N-benzyl-2-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-pyridinyl]-5-phenylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 90386097 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-benzyl-2-[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3-pyridinyl]-5-phenylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | CC1(C)OCC(c2cncc(-c3nc(NCc4ccccc4)c4c(-c5ccccc5)ccn4n3)c2)O1 |
| InChI | InChI=1S/C29H27N5O2/c1-29(2)35-19-25(36-29)22-15-23(18-30-17-22)27-32-28(31-16-20-9-5-3-6-10-20)26-24(13-14-34(26)33-27)21-11-7-4-8-12-21/h3-15,17-18,25H,16,19H2,1-2H3,(H,31,32,33) |
| InChIKey | FUIVNBYAASAWNU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |