C27H28N8O3S — CID 90386105
N-tert-butyl-5-[5-phenyl-4-(2-pyrazin-2-yloxyethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide (PubChem CID 90386105) has the molecular formula C27H28N8O3S and a molecular weight of 544.64 g/mol. Its IUPAC name is N-tert-butyl-5-[5-phenyl-4-(2-pyrazin-2-yloxyethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide.
| Compound Name | N-tert-butyl-5-[5-phenyl-4-(2-pyrazin-2-yloxyethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 90386105 |
| Molecular Formula | C27H28N8O3S |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | N-tert-butyl-5-[5-phenyl-4-(2-pyrazin-2-yloxyethylamino)pyrrolo[2,1-f][1,2,4]triazin-2-yl]pyridine-3-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cncc(-c2nc(NCCOc3cnccn3)c3c(-c4ccccc4)ccn3n2)c1 |
| InChI | InChI=1S/C27H28N8O3S/c1-27(2,3)34-39(36,37)21-15-20(16-29-17-21)25-32-26(31-12-14-38-23-18-28-10-11-30-23)24-22(9-13-35(24)33-25)19-7-5-4-6-8-19/h4-11,13,15-18,34H,12,14H2,1-3H3,(H,31,32,33) |
| InChIKey | BYUZNNLMGIRNIH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 136.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|