C25H21N7O3S — CID 90386474
5-[4-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-phenylpyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methoxypyridine-3-sulfonamide (PubChem CID 90386474) has the molecular formula C25H21N7O3S and a molecular weight of 499.56 g/mol. Its IUPAC name is 5-[4-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-phenylpyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methoxypyridine-3-sulfonamide.
| Compound Name | 5-[4-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-phenylpyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 90386474 |
| Molecular Formula | C25H21N7O3S |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | 5-[4-(5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-phenylpyrrolo[2,1-f][1,2,4]triazin-2-yl]-2-methoxypyridine-3-sulfonamide |
| SMILES | COc1ncc(-c2nc(N3Cc4cccnc4C3)c3c(-c4ccccc4)ccn3n2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C25H21N7O3S/c1-35-25-21(36(26,33)34)12-18(13-28-25)23-29-24(31-14-17-8-5-10-27-20(17)15-31)22-19(9-11-32(22)30-23)16-6-3-2-4-7-16/h2-13H,14-15H2,1H3,(H2,26,33,34) |
| InChIKey | IEFIVJDKXCPMEN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |