C30H37N3O9S2Si — CID 90386943
6-methoxycarbonyl-3-methyl-1-[5-[methylsulfonylmethyl(sulfino)amino]-2-phenoxyphenyl]-4-oxo-2-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[3,4-c]pyridine (PubChem CID 90386943) has the molecular formula C30H37N3O9S2Si and a molecular weight of 675.86 g/mol. Its IUPAC name is 6-methoxycarbonyl-3-methyl-1-[5-[methylsulfonylmethyl(sulfino)amino]-2-phenoxyphenyl]-4-oxo-2-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[3,4-c]pyridine.
| Compound Name | 6-methoxycarbonyl-3-methyl-1-[5-[methylsulfonylmethyl(sulfino)amino]-2-phenoxyphenyl]-4-oxo-2-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 90386943 |
| Molecular Formula | C30H37N3O9S2Si |
| Molecular Weight | 675.86 g/mol |
| Exact Mass | 675.17 |
| IUPAC Name | 6-methoxycarbonyl-3-methyl-1-[5-[methylsulfonylmethyl(sulfino)amino]-2-phenoxyphenyl]-4-oxo-2-(2-trimethylsilylethoxymethyl)-5H-pyrrolo[3,4-c]pyridine |
| SMILES | COC(=O)c1cc2c(-c3cc(N(CS(C)(=O)=O)S(=O)O)ccc3Oc3ccccc3)n(COCC[Si](C)(C)C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C30H37N3O9S2Si/c1-20-27-24(17-25(30(35)40-2)31-29(27)34)28(32(20)18-41-14-15-45(4,5)6)23-16-21(33(43(36)37)19-44(3,38)39)12-13-26(23)42-22-10-8-7-9-11-22/h7-13,16-17H,14-15,18-19H2,1-6H3,(H,31,34)(H,36,37) |
| InChIKey | RKPQIURWMQRQDU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 157.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.86 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|