C17H14ClN3O2 — CID 90387467
4-(1-chloro-8-methoxy-5H-pyrido[4,3-b]indol-7-yl)-3,5-dimethyl-1,2-oxazole (PubChem CID 90387467) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is 4-(1-chloro-8-methoxy-5H-pyrido[4,3-b]indol-7-yl)-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-(1-chloro-8-methoxy-5H-pyrido[4,3-b]indol-7-yl)-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 90387467 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-(1-chloro-8-methoxy-5H-pyrido[4,3-b]indol-7-yl)-3,5-dimethyl-1,2-oxazole |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)[nH]c1ccnc(Cl)c12 |
| InChI | InChI=1S/C17H14ClN3O2/c1-8-15(9(2)23-21-8)11-6-13-10(7-14(11)22-3)16-12(20-13)4-5-19-17(16)18/h4-7,20H,1-3H3 |
| InChIKey | HQWHFYOMOHBRTB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|