C35H36N6O3 — CID 90387667
[4-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]naphthalen-1-yl]-(3,3,4-trimethylpiperazin-1-yl)methanone (PubChem CID 90387667) has the molecular formula C35H36N6O3 and a molecular weight of 588.71 g/mol. Its IUPAC name is [4-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]naphthalen-1-yl]-(3,3,4-trimethylpiperazin-1-yl)methanone.
| Compound Name | [4-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]naphthalen-1-yl]-(3,3,4-trimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 90387667 |
| Molecular Formula | C35H36N6O3 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.28 |
| IUPAC Name | [4-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]naphthalen-1-yl]-(3,3,4-trimethylpiperazin-1-yl)methanone |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)[nH]c1nc(C)nc(-c3ccc(C(=O)N4CCN(C)C(C)(C)C4)c4ccccc34)c12 |
| InChI | InChI=1S/C35H36N6O3/c1-19-30(20(2)44-39-19)27-16-28-26(17-29(27)43-7)31-32(36-21(3)37-33(31)38-28)24-12-13-25(23-11-9-8-10-22(23)24)34(42)41-15-14-40(6)35(4,5)18-41/h8-13,16-17H,14-15,18H2,1-7H3,(H,36,37,38) |
| InChIKey | DMDSZZAWPLJPPM-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |