C19H25BN2O4 — CID 90387798
methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]amino]propanoate (PubChem CID 90387798) has the molecular formula C19H25BN2O4 and a molecular weight of 356.23 g/mol. Its IUPAC name is methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]amino]propanoate.
| Compound Name | methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 90387798 |
| Molecular Formula | C19H25BN2O4 |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | methyl 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]amino]propanoate |
| SMILES | COC(=O)CCNc1cc(B2OC(C)(C)C(C)(C)O2)c2ccccc2n1 |
| InChI | InChI=1S/C19H25BN2O4/c1-18(2)19(3,4)26-20(25-18)14-12-16(21-11-10-17(23)24-5)22-15-9-7-6-8-13(14)15/h6-9,12H,10-11H2,1-5H3,(H,21,22) |
| InChIKey | BJPBHBRNLMVZTL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|