C19H28BN3O2 — CID 90387864
N',N'-dimethyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]ethane-1,2-diamine (PubChem CID 90387864) has the molecular formula C19H28BN3O2 and a molecular weight of 341.26 g/mol. Its IUPAC name is N',N'-dimethyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 90387864 |
| Molecular Formula | C19H28BN3O2 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | N',N'-dimethyl-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-yl]ethane-1,2-diamine |
| SMILES | CN(C)CCNc1cc(B2OC(C)(C)C(C)(C)O2)c2ccccc2n1 |
| InChI | InChI=1S/C19H28BN3O2/c1-18(2)19(3,4)25-20(24-18)15-13-17(21-11-12-23(5)6)22-16-10-8-7-9-14(15)16/h7-10,13H,11-12H2,1-6H3,(H,21,22) |
| InChIKey | VRPJTKYONOQSAM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|