C23H35BN4O2 — CID 90387956
N-[3-(4-methylpiperazin-1-yl)propyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine (PubChem CID 90387956) has the molecular formula C23H35BN4O2 and a molecular weight of 410.37 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 90387956 |
| Molecular Formula | C23H35BN4O2 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine |
| SMILES | CN1CCN(CCCNc2cc(B3OC(C)(C)C(C)(C)O3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C23H35BN4O2/c1-22(2)23(3,4)30-24(29-22)19-17-21(26-20-10-7-6-9-18(19)20)25-11-8-12-28-15-13-27(5)14-16-28/h6-7,9-10,17H,8,11-16H2,1-5H3,(H,25,26) |
| InChIKey | TYPWZGAAFJVCAV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|