C21H30BN3O3 — CID 90387987
N-(2-morpholin-4-ylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine (PubChem CID 90387987) has the molecular formula C21H30BN3O3 and a molecular weight of 383.30 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine.
| Compound Name | N-(2-morpholin-4-ylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine |
|---|---|
| PubChem CID | 90387987 |
| Molecular Formula | C21H30BN3O3 |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2-amine |
| SMILES | CC1(C)OB(c2cc(NCCN3CCOCC3)nc3ccccc23)OC1(C)C |
| InChI | InChI=1S/C21H30BN3O3/c1-20(2)21(3,4)28-22(27-20)17-15-19(24-18-8-6-5-7-16(17)18)23-9-10-25-11-13-26-14-12-25/h5-8,15H,9-14H2,1-4H3,(H,23,24) |
| InChIKey | UXKLQBRDOMLUPS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|