C18H17ClN4O — CID 90388075
1-chloro-8-methoxy-7-(1,3,5-trimethylpyrazol-4-yl)-5H-pyrido[4,3-b]indole (PubChem CID 90388075) has the molecular formula C18H17ClN4O and a molecular weight of 340.81 g/mol. Its IUPAC name is 1-chloro-8-methoxy-7-(1,3,5-trimethylpyrazol-4-yl)-5H-pyrido[4,3-b]indole.
| Compound Name | 1-chloro-8-methoxy-7-(1,3,5-trimethylpyrazol-4-yl)-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 90388075 |
| Molecular Formula | C18H17ClN4O |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-chloro-8-methoxy-7-(1,3,5-trimethylpyrazol-4-yl)-5H-pyrido[4,3-b]indole |
| SMILES | COc1cc2c(cc1-c1c(C)nn(C)c1C)[nH]c1ccnc(Cl)c12 |
| InChI | InChI=1S/C18H17ClN4O/c1-9-16(10(2)23(3)22-9)12-7-14-11(8-15(12)24-4)17-13(21-14)5-6-20-18(17)19/h5-8,21H,1-4H3 |
| InChIKey | LVQHGMXOYRNRQU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|