C29H26FN4O6+ — CID 90388251
1-[3-(1,3-dioxoisoindol-2-yl)propyl]-7-(4-fluorophenyl)-4-hydroxy-N-(2-hydroxyethyl)-1-methyl-2-oxo-1,5-naphthyridin-1-ium-3-carboxamide (PubChem CID 90388251) has the molecular formula C29H26FN4O6+ and a molecular weight of 545.55 g/mol. Its IUPAC name is 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-7-(4-fluorophenyl)-4-hydroxy-N-(2-hydroxyethyl)-1-methyl-2-oxo-1,5-naphthyridin-1-ium-3-carboxamide.
| Compound Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-7-(4-fluorophenyl)-4-hydroxy-N-(2-hydroxyethyl)-1-methyl-2-oxo-1,5-naphthyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 90388251 |
| Molecular Formula | C29H26FN4O6+ |
| Molecular Weight | 545.55 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 1-[3-(1,3-dioxoisoindol-2-yl)propyl]-7-(4-fluorophenyl)-4-hydroxy-N-(2-hydroxyethyl)-1-methyl-2-oxo-1,5-naphthyridin-1-ium-3-carboxamide |
| SMILES | C[N+]1(CCCN2C(=O)c3ccccc3C2=O)C(=O)C(C(=O)NCCO)=C(O)c2ncc(-c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C29H25FN4O6/c1-34(13-4-12-33-27(38)20-5-2-3-6-21(20)28(33)39)22-15-18(17-7-9-19(30)10-8-17)16-32-24(22)25(36)23(29(34)40)26(37)31-11-14-35/h2-3,5-10,15-16,35H,4,11-14H2,1H3,(H-,31,36,37,40)/p+1 |
| InChIKey | MHFGELZSKLYWFG-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.55 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|