C30H29N5O4S — CID 90388345
3-(1-benzothiophen-2-yl)-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazin-6-amine;3,4-dimethoxyaniline (PubChem CID 90388345) has the molecular formula C30H29N5O4S and a molecular weight of 555.66 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazin-6-amine;3,4-dimethoxyaniline.
| Compound Name | 3-(1-benzothiophen-2-yl)-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazin-6-amine;3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 90388345 |
| Molecular Formula | C30H29N5O4S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-N-(3,4-dimethoxyphenyl)imidazo[1,2-b]pyridazin-6-amine;3,4-dimethoxyaniline |
| SMILES | COc1ccc(N)cc1OC.COc1ccc(Nc2ccc3ncc(-c4cc5ccccc5s4)n3n2)cc1OC |
| InChI | InChI=1S/C22H18N4O2S.C8H11NO2/c1-27-17-8-7-15(12-18(17)28-2)24-21-9-10-22-23-13-16(26(22)25-21)20-11-14-5-3-4-6-19(14)29-20;1-10-7-4-3-6(9)5-8(7)11-2/h3-13H,1-2H3,(H,24,25);3-5H,9H2,1-2H3 |
| InChIKey | ZTPUHLQJRDKLTA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|