C25H23N5O2 — CID 90388347
N-(3,4-dimethoxyphenyl)-3-(1-prop-2-enylindol-2-yl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 90388347) has the molecular formula C25H23N5O2 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-3-(1-prop-2-enylindol-2-yl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | N-(3,4-dimethoxyphenyl)-3-(1-prop-2-enylindol-2-yl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 90388347 |
| Molecular Formula | C25H23N5O2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-3-(1-prop-2-enylindol-2-yl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | C=CCn1c(-c2cnc3ccc(Nc4ccc(OC)c(OC)c4)nn23)cc2ccccc21 |
| InChI | InChI=1S/C25H23N5O2/c1-4-13-29-19-8-6-5-7-17(19)14-20(29)21-16-26-25-12-11-24(28-30(21)25)27-18-9-10-22(31-2)23(15-18)32-3/h4-12,14-16H,1,13H2,2-3H3,(H,27,28) |
| InChIKey | JVNPPNWUZSUISG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 65.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|