C23H21N5O2 — CID 90388459
3-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]aniline (PubChem CID 90388459) has the molecular formula C23H21N5O2 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]aniline.
| Compound Name | 3-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]aniline |
|---|---|
| PubChem CID | 90388459 |
| Molecular Formula | C23H21N5O2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 3-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-2-methyl-9H-pyrimido[4,5-b]indol-4-yl]aniline |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)[nH]c1nc(C)nc(-c3cccc(N)c3)c12 |
| InChI | InChI=1S/C23H21N5O2/c1-11-20(12(2)30-28-11)17-9-18-16(10-19(17)29-4)21-22(14-6-5-7-15(24)8-14)25-13(3)26-23(21)27-18/h5-10H,24H2,1-4H3,(H,25,26,27) |
| InChIKey | GCHDYIRBHRRXKN-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|