C32H33N5O6S — CID 90388654
3-(1-benzothiophen-2-yl)-N-(3,4,5-trimethoxyphenyl)imidazo[1,2-b]pyridazin-6-amine;3,4,5-trimethoxyaniline (PubChem CID 90388654) has the molecular formula C32H33N5O6S and a molecular weight of 615.71 g/mol. Its IUPAC name is 3-(1-benzothiophen-2-yl)-N-(3,4,5-trimethoxyphenyl)imidazo[1,2-b]pyridazin-6-amine;3,4,5-trimethoxyaniline.
| Compound Name | 3-(1-benzothiophen-2-yl)-N-(3,4,5-trimethoxyphenyl)imidazo[1,2-b]pyridazin-6-amine;3,4,5-trimethoxyaniline |
|---|---|
| PubChem CID | 90388654 |
| Molecular Formula | C32H33N5O6S |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | 3-(1-benzothiophen-2-yl)-N-(3,4,5-trimethoxyphenyl)imidazo[1,2-b]pyridazin-6-amine;3,4,5-trimethoxyaniline |
| SMILES | COc1cc(N)cc(OC)c1OC.COc1cc(Nc2ccc3ncc(-c4cc5ccccc5s4)n3n2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N4O3S.C9H13NO3/c1-28-17-11-15(12-18(29-2)23(17)30-3)25-21-8-9-22-24-13-16(27(22)26-21)20-10-14-6-4-5-7-19(14)31-20;1-11-7-4-6(10)5-8(12-2)9(7)13-3/h4-13H,1-3H3,(H,25,26);4-5H,10H2,1-3H3 |
| InChIKey | UOHCCVBSXRAZNR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|