C28H21N5O4S — CID 90388675
1,3-benzodioxol-5-amine;N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 90388675) has the molecular formula C28H21N5O4S and a molecular weight of 523.57 g/mol. Its IUPAC name is 1,3-benzodioxol-5-amine;N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 1,3-benzodioxol-5-amine;N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 90388675 |
| Molecular Formula | C28H21N5O4S |
| Molecular Weight | 523.57 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 1,3-benzodioxol-5-amine;N-(1,3-benzodioxol-5-yl)-3-(1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | Nc1ccc2c(c1)OCO2.c1ccc2sc(-c3cnc4ccc(Nc5ccc6c(c5)OCO6)nn34)cc2c1 |
| InChI | InChI=1S/C21H14N4O2S.C7H7NO2/c1-2-4-18-13(3-1)9-19(28-18)15-11-22-21-8-7-20(24-25(15)21)23-14-5-6-16-17(10-14)27-12-26-16;8-5-1-2-6-7(3-5)10-4-9-6/h1-11H,12H2,(H,23,24);1-3H,4,8H2 |
| InChIKey | WKZPLZGANRTTGF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|