C11H17NO — CID 90388765
1,4,4-trimethyl-3,3a,5,6-tetrahydroindol-2-one (PubChem CID 90388765) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1,4,4-trimethyl-3,3a,5,6-tetrahydroindol-2-one.
| Compound Name | 1,4,4-trimethyl-3,3a,5,6-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 90388765 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1,4,4-trimethyl-3,3a,5,6-tetrahydroindol-2-one |
| SMILES | CN1C(=O)CC2C1=CCCC2(C)C |
| InChI | InChI=1S/C11H17NO/c1-11(2)6-4-5-9-8(11)7-10(13)12(9)3/h5,8H,4,6-7H2,1-3H3 |
| InChIKey | RPVWDZBOIHWCAS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |