About dichloromethanol;hydrate
dichloromethanol;hydrate (PubChem CID 90388794) has the molecular formula CH4Cl2O2
and a molecular weight of 118.95 g/mol. Its IUPAC name is dichloromethanol;hydrate.
Molecular Properties
| Compound Name | dichloromethanol;hydrate |
| PubChem CID | 90388794 |
| Molecular Formula | CH4Cl2O2 |
| Molecular Weight | 118.95 g/mol |
| Exact Mass | 117.96 |
| IUPAC Name | dichloromethanol;hydrate |
| SMILES | O.OC(Cl)Cl |
| InChI | InChI=1S/CH2Cl2O.H2O/c2-1(3)4;/h1,4H;1H2 |
| InChIKey | NPEJQCGTJTXWNV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.95 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethanol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethanol;hydrate?
The IUPAC name of dichloromethanol;hydrate (CID 90388794) is dichloromethanol;hydrate.
What is the SMILES notation for dichloromethanol;hydrate?
The canonical SMILES for dichloromethanol;hydrate is O.OC(Cl)Cl.
What is the InChIKey of dichloromethanol;hydrate?
The InChIKey is NPEJQCGTJTXWNV-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2Cl2O.H2O/c2-1(3)4;/h1,4H;1H2.
What are the key properties of dichloromethanol;hydrate?
dichloromethanol;hydrate has a molecular weight of 118.95 g/mol, XLogP of -0.08, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethanol;hydrate is sourced from PubChem (CID 90388794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).