About N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide
N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide (PubChem CID 90389377) has the molecular formula C11H24N8O2
and a molecular weight of 300.37 g/mol. Its IUPAC name is N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide |
| PubChem CID | 90389377 |
| Molecular Formula | C11H24N8O2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCOCC1.[H]/N=C(\N=C(N)N)N1CCOCC1 |
| InChI | InChI=1S/C6H13N5O.C5H11N3O/c7-5(8)10-6(9)11-1-3-12-4-2-11;6-5(7)8-1-3-9-4-2-8/h1-4H2,(H5,7,8,9,10);1-4H2,(H3,6,7) |
| InChIKey | ZNFFTPCQUGJJGL-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 163.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide?
The IUPAC name of N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide (CID 90389377) is N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide.
What is the SMILES notation for N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide?
The canonical SMILES for N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide is [H]/N=C(\N)N1CCOCC1.[H]/N=C(\N=C(N)N)N1CCOCC1.
What is the InChIKey of N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide?
The InChIKey is ZNFFTPCQUGJJGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N5O.C5H11N3O/c7-5(8)10-6(9)11-1-3-12-4-2-11;6-5(7)8-1-3-9-4-2-8/h1-4H2,(H5,7,8,9,10);1-4H2,(H3,6,7).
What are the key properties of N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide?
N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide has a molecular weight of 300.37 g/mol, XLogP of -2.26, 0 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)morpholine-4-carboximidamide;morpholine-4-carboximidamide is sourced from PubChem (CID 90389377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).