About [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate
[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate (PubChem CID 90389661) has the molecular formula C18H11F3N2O3S
and a molecular weight of 392.36 g/mol. Its IUPAC name is [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 90389661 |
| Molecular Formula | C18H11F3N2O3S |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccc(-c2ccnc3[nH]c4ccccc4c23)c1)C(F)(F)F |
| InChI | InChI=1S/C18H11F3N2O3S/c19-18(20,21)27(24,25)26-12-5-3-4-11(10-12)13-8-9-22-17-16(13)14-6-1-2-7-15(14)23-17/h1-10H,(H,22,23) |
| InChIKey | UTPFOZUZGFSKSE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate (CID 90389661) is [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate is O=S(=O)(Oc1cccc(-c2ccnc3[nH]c4ccccc4c23)c1)C(F)(F)F.
What is the InChIKey of [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is UTPFOZUZGFSKSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F3N2O3S/c19-18(20,21)27(24,25)26-12-5-3-4-11(10-12)13-8-9-22-17-16(13)14-6-1-2-7-15(14)23-17/h1-10H,(H,22,23).
What are the key properties of [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate?
[3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 392.36 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(9H-pyrido[2,3-b]indol-4-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 90389661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).