About 3-(2-methylbutyl)oxane-2,6-dione
3-(2-methylbutyl)oxane-2,6-dione (PubChem CID 90389664) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 3-(2-methylbutyl)oxane-2,6-dione.
Molecular Properties
| Compound Name | 3-(2-methylbutyl)oxane-2,6-dione |
| PubChem CID | 90389664 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 3-(2-methylbutyl)oxane-2,6-dione |
| SMILES | CCC(C)CC1CCC(=O)OC1=O |
| InChI | InChI=1S/C10H16O3/c1-3-7(2)6-8-4-5-9(11)13-10(8)12/h7-8H,3-6H2,1-2H3 |
| InChIKey | SQXBGIPADIEGHW-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylbutyl)oxane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylbutyl)oxane-2,6-dione?
The IUPAC name of 3-(2-methylbutyl)oxane-2,6-dione (CID 90389664) is 3-(2-methylbutyl)oxane-2,6-dione.
What is the SMILES notation for 3-(2-methylbutyl)oxane-2,6-dione?
The canonical SMILES for 3-(2-methylbutyl)oxane-2,6-dione is CCC(C)CC1CCC(=O)OC1=O.
What is the InChIKey of 3-(2-methylbutyl)oxane-2,6-dione?
The InChIKey is SQXBGIPADIEGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-3-7(2)6-8-4-5-9(11)13-10(8)12/h7-8H,3-6H2,1-2H3.
What are the key properties of 3-(2-methylbutyl)oxane-2,6-dione?
3-(2-methylbutyl)oxane-2,6-dione has a molecular weight of 184.23 g/mol, XLogP of 1.90, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylbutyl)oxane-2,6-dione is sourced from PubChem (CID 90389664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).