C24H33N3O2 — CID 9038968
2-[[2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl]-propylamino]-N-(2-methylphenyl)acetamide (PubChem CID 9038968) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 2-[[2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl]-propylamino]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[[2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl]-propylamino]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9038968 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 2-[[2-[2-[(2R)-butan-2-yl]anilino]-2-oxoethyl]-propylamino]-N-(2-methylphenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)CC(=O)Nc1ccccc1[C@H](C)CC |
| InChI | InChI=1S/C24H33N3O2/c1-5-15-27(16-23(28)25-21-13-9-7-11-19(21)4)17-24(29)26-22-14-10-8-12-20(22)18(3)6-2/h7-14,18H,5-6,15-17H2,1-4H3,(H,25,28)(H,26,29)/t18-/m1/s1 |
| InChIKey | YRTNPDNGRYLUGW-GOSISDBHSA-N |
| XLogP | 4.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |