C13H18N2O4 — CID 90389751
5-[(4-methoxy-2-pyridinyl)oxy]-2-methylpiperidine-1-carboxylic acid (PubChem CID 90389751) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-[(4-methoxy-2-pyridinyl)oxy]-2-methylpiperidine-1-carboxylic acid.
| Compound Name | 5-[(4-methoxy-2-pyridinyl)oxy]-2-methylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90389751 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 5-[(4-methoxy-2-pyridinyl)oxy]-2-methylpiperidine-1-carboxylic acid |
| SMILES | COc1ccnc(OC2CCC(C)N(C(=O)O)C2)c1 |
| InChI | InChI=1S/C13H18N2O4/c1-9-3-4-11(8-15(9)13(16)17)19-12-7-10(18-2)5-6-14-12/h5-7,9,11H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | XAWQJKIXFQJHCI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |