C23H29N7O3 — CID 90389779
[1-[4-[[3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclohexyl]piperidin-4-yl] formate (PubChem CID 90389779) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is [1-[4-[[3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclohexyl]piperidin-4-yl] formate.
| Compound Name | [1-[4-[[3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclohexyl]piperidin-4-yl] formate |
|---|---|
| PubChem CID | 90389779 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | [1-[4-[[3-(4-methoxyphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclohexyl]piperidin-4-yl] formate |
| SMILES | COc1ccc(-n2nnc3cnc(NC4CCC(N5CCC(OC=O)CC5)CC4)nc32)cc1 |
| InChI | InChI=1S/C23H29N7O3/c1-32-19-8-6-18(7-9-19)30-22-21(27-28-30)14-24-23(26-22)25-16-2-4-17(5-3-16)29-12-10-20(11-13-29)33-15-31/h6-9,14-17,20H,2-5,10-13H2,1H3,(H,24,25,26) |
| InChIKey | NXYXMWFSHPVGMW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|