About trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol
trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol (PubChem CID 90389969) has the molecular formula C18H21N5O2
and a molecular weight of 339.40 g/mol. Its IUPAC name is trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol |
| PubChem CID | 90389969 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol |
| SMILES | CCOc1ccc(-n2cnc3cnc(N[C@H]4CC[C@H](O)C4)nc32)cc1 |
| InChI | InChI=1S/C18H21N5O2/c1-2-25-15-7-4-13(5-8-15)23-11-20-16-10-19-18(22-17(16)23)21-12-3-6-14(24)9-12/h4-5,7-8,10-12,14,24H,2-3,6,9H2,1H3,(H,19,21,22)/t12-,14-/m0/s1 |
| InChIKey | MIGIFQORLNWZLJ-JSGCOSHPSA-N |
| XLogP | 2.54 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol?
The IUPAC name of trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol (CID 90389969) is trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol.
What is the SMILES notation for trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol?
The canonical SMILES for trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol is CCOc1ccc(-n2cnc3cnc(N[C@H]4CC[C@H](O)C4)nc32)cc1.
What is the InChIKey of trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol?
The InChIKey is MIGIFQORLNWZLJ-JSGCOSHPSA-N. The full InChI is InChI=1S/C18H21N5O2/c1-2-25-15-7-4-13(5-8-15)23-11-20-16-10-19-18(22-17(16)23)21-12-3-6-14(24)9-12/h4-5,7-8,10-12,14,24H,2-3,6,9H2,1H3,(H,19,21,22)/t12-,14-/m0/s1.
What are the key properties of trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol?
trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol has a molecular weight of 339.40 g/mol, XLogP of 2.54, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,3S)-3-[[9-(4-ethoxyphenyl)purin-2-yl]amino]cyclopentan-1-ol is sourced from PubChem (CID 90389969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).