C19H23N7O — CID 90390098
trans-(1S,3S)-3-[[3-(4-pyrrolidin-1-ylphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol (PubChem CID 90390098) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is trans-(1S,3S)-3-[[3-(4-pyrrolidin-1-ylphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol.
| Compound Name | trans-(1S,3S)-3-[[3-(4-pyrrolidin-1-ylphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 90390098 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | trans-(1S,3S)-3-[[3-(4-pyrrolidin-1-ylphenyl)triazolo[4,5-d]pyrimidin-5-yl]amino]cyclopentan-1-ol |
| SMILES | O[C@H]1CC[C@H](Nc2ncc3nnn(-c4ccc(N5CCCC5)cc4)c3n2)C1 |
| InChI | InChI=1S/C19H23N7O/c27-16-8-3-13(11-16)21-19-20-12-17-18(22-19)26(24-23-17)15-6-4-14(5-7-15)25-9-1-2-10-25/h4-7,12-13,16,27H,1-3,8-11H2,(H,20,21,22)/t13-,16-/m0/s1 |
| InChIKey | AOODTDKNJQOTHW-BBRMVZONSA-N |
| XLogP | 2.14 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|