C11H21N2O5+ — CID 90390366
(1-acetyloxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy-methoxy-oxoazanium (PubChem CID 90390366) has the molecular formula C11H21N2O5+ and a molecular weight of 261.30 g/mol. Its IUPAC name is (1-acetyloxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy-methoxy-oxoazanium.
| Compound Name | (1-acetyloxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy-methoxy-oxoazanium |
|---|---|
| PubChem CID | 90390366 |
| Molecular Formula | C11H21N2O5+ |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (1-acetyloxy-2,2,5,5-tetramethylpyrrolidin-3-yl)oxy-methoxy-oxoazanium |
| SMILES | CO[N+](=O)OC1CC(C)(C)N(OC(C)=O)C1(C)C |
| InChI | InChI=1S/C11H21N2O5/c1-8(14)17-12-10(2,3)7-9(11(12,4)5)18-13(15)16-6/h9H,7H2,1-6H3/q+1 |
| InChIKey | FGNDZGZBUWDOMA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|