About 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran
6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran (PubChem CID 90390543) has the molecular formula C15H7Cl3F3NO3
and a molecular weight of 412.58 g/mol. Its IUPAC name is 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran.
Molecular Properties
| Compound Name | 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran |
| PubChem CID | 90390543 |
| Molecular Formula | C15H7Cl3F3NO3 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 410.94 |
| IUPAC Name | 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran |
| SMILES | O=[N+]([O-])c1cc2c(cc1Cl)OC(c1cc(Cl)cc(Cl)c1)(C(F)(F)F)C2 |
| InChI | InChI=1S/C15H7Cl3F3NO3/c16-9-2-8(3-10(17)4-9)14(15(19,20)21)6-7-1-12(22(23)24)11(18)5-13(7)25-14/h1-5H,6H2 |
| InChIKey | CYBJJJUPBDHXEK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran?
The IUPAC name of 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran (CID 90390543) is 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran.
What is the SMILES notation for 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran?
The canonical SMILES for 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran is O=[N+]([O-])c1cc2c(cc1Cl)OC(c1cc(Cl)cc(Cl)c1)(C(F)(F)F)C2.
What is the InChIKey of 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran?
The InChIKey is CYBJJJUPBDHXEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7Cl3F3NO3/c16-9-2-8(3-10(17)4-9)14(15(19,20)21)6-7-1-12(22(23)24)11(18)5-13(7)25-14/h1-5H,6H2.
What are the key properties of 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran?
6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran has a molecular weight of 412.58 g/mol, XLogP of 5.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(3,5-dichlorophenyl)-5-nitro-2-(trifluoromethyl)-3H-1-benzofuran is sourced from PubChem (CID 90390543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).