C33H39BrFN3O3Si — CID 90391269
(9S)-4-bromo-9-[tert-butyl(dimethyl)silyl]oxy-12-(6-tert-butyl-8-fluoro-1-oxophthalazin-2-yl)-6-methyl-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,12,14-pentaen-5-one (PubChem CID 90391269) has the molecular formula C33H39BrFN3O3Si and a molecular weight of 652.68 g/mol. Its IUPAC name is (9S)-4-bromo-9-[tert-butyl(dimethyl)silyl]oxy-12-(6-tert-butyl-8-fluoro-1-oxophthalazin-2-yl)-6-methyl-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,12,14-pentaen-5-one.
| Compound Name | (9S)-4-bromo-9-[tert-butyl(dimethyl)silyl]oxy-12-(6-tert-butyl-8-fluoro-1-oxophthalazin-2-yl)-6-methyl-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,12,14-pentaen-5-one |
|---|---|
| PubChem CID | 90391269 |
| Molecular Formula | C33H39BrFN3O3Si |
| Molecular Weight | 652.68 g/mol |
| Exact Mass | 651.19 |
| IUPAC Name | (9S)-4-bromo-9-[tert-butyl(dimethyl)silyl]oxy-12-(6-tert-butyl-8-fluoro-1-oxophthalazin-2-yl)-6-methyl-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,12,14-pentaen-5-one |
| SMILES | Cn1c2c(cc(Br)c1=O)-c1cccc(-n3ncc4cc(C(C)(C)C)cc(F)c4c3=O)c1C[C@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C33H39BrFN3O3Si/c1-32(2,3)20-13-19-18-36-38(31(40)29(19)26(35)14-20)27-12-10-11-22-23(27)15-21(41-42(8,9)33(4,5)6)16-28-24(22)17-25(34)30(39)37(28)7/h10-14,17-18,21H,15-16H2,1-9H3/t21-/m0/s1 |
| InChIKey | UORRHICFBZZIDT-NRFANRHFSA-N |
| XLogP | 7.44 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.68 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|