C25H18N2O4S2 — CID 90391275
4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-phenyl-1H-benzimidazole (PubChem CID 90391275) has the molecular formula C25H18N2O4S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-phenyl-1H-benzimidazole.
| Compound Name | 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-phenyl-1H-benzimidazole |
|---|---|
| PubChem CID | 90391275 |
| Molecular Formula | C25H18N2O4S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.07 |
| IUPAC Name | 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-phenyl-1H-benzimidazole |
| SMILES | c1ccc(-c2nc3c(-c4scc5c4OCCO5)ccc(-c4scc5c4OCCO5)c3[nH]2)cc1 |
| InChI | InChI=1S/C25H18N2O4S2/c1-2-4-14(5-3-1)25-26-19-15(23-21-17(12-32-23)28-8-10-30-21)6-7-16(20(19)27-25)24-22-18(13-33-24)29-9-11-31-22/h1-7,12-13H,8-11H2,(H,26,27) |
| InChIKey | DZQCGYHLTRNMDC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |