C18H16Cl2N6O — CID 90391762
4-[4-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2,6-dichlorophenyl]phenoxy]butanenitrile (PubChem CID 90391762) has the molecular formula C18H16Cl2N6O and a molecular weight of 403.27 g/mol. Its IUPAC name is 4-[4-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2,6-dichlorophenyl]phenoxy]butanenitrile.
| Compound Name | 4-[4-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2,6-dichlorophenyl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 90391762 |
| Molecular Formula | C18H16Cl2N6O |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 4-[4-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2,6-dichlorophenyl]phenoxy]butanenitrile |
| SMILES | N#CCCCOc1ccc(-c2c(Cl)cc(Nc3n[nH]c(N)n3)cc2Cl)cc1 |
| InChI | InChI=1S/C18H16Cl2N6O/c19-14-9-12(23-18-24-17(22)25-26-18)10-15(20)16(14)11-3-5-13(6-4-11)27-8-2-1-7-21/h3-6,9-10H,1-2,8H2,(H4,22,23,24,25,26) |
| InChIKey | VNSSVDHRMVDWSR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|