C25H40O3 — CID 90391869
[(3R,5R,6S,10R,13R,17R)-17-[(2R)-but-3-en-2-yl]-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] acetate (PubChem CID 90391869) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is [(3R,5R,6S,10R,13R,17R)-17-[(2R)-but-3-en-2-yl]-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] acetate.
| Compound Name | [(3R,5R,6S,10R,13R,17R)-17-[(2R)-but-3-en-2-yl]-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] acetate |
|---|---|
| PubChem CID | 90391869 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | [(3R,5R,6S,10R,13R,17R)-17-[(2R)-but-3-en-2-yl]-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-6-yl] acetate |
| SMILES | C=C[C@@H](C)[C@H]1CCC2C3C[C@H](OC(C)=O)[C@@H]4C[C@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C25H40O3/c1-6-15(2)19-7-8-20-18-14-23(28-16(3)26)22-13-17(27)9-11-25(22,5)21(18)10-12-24(19,20)4/h6,15,17-23,27H,1,7-14H2,2-5H3/t15-,17-,18?,19-,20?,21?,22+,23+,24-,25-/m1/s1 |
| InChIKey | QEKPVNYUWJUMCT-HXPPYBRWSA-N |
| XLogP | 5.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|