C10H14N2 — CID 90392293
4-[(1Z,3Z)-penta-1,3-dienyl]-1,2-dihydropyridin-2-amine (PubChem CID 90392293) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 4-[(1Z,3Z)-penta-1,3-dienyl]-1,2-dihydropyridin-2-amine.
| Compound Name | 4-[(1Z,3Z)-penta-1,3-dienyl]-1,2-dihydropyridin-2-amine |
|---|---|
| PubChem CID | 90392293 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 4-[(1Z,3Z)-penta-1,3-dienyl]-1,2-dihydropyridin-2-amine |
| SMILES | C/C=C\C=C/C1=CC(N)NC=C1 |
| InChI | InChI=1S/C10H14N2/c1-2-3-4-5-9-6-7-12-10(11)8-9/h2-8,10,12H,11H2,1H3/b3-2-,5-4- |
| InChIKey | FGDRGMGAHCXTSN-LDIADDGTSA-N |
| XLogP | 1.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|