About 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile
4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile (PubChem CID 90392328) has the molecular formula C22H21N3O2
and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile |
| PubChem CID | 90392328 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile |
| SMILES | Cc1ccc(-c2cc([C@@]3(O)CCC(O)C3)nn2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C22H21N3O2/c1-15-2-6-17(7-3-15)20-12-21(22(27)11-10-19(26)13-22)24-25(20)18-8-4-16(14-23)5-9-18/h2-9,12,19,26-27H,10-11,13H2,1H3/t19?,22-/m1/s1 |
| InChIKey | RMKCXLAPORXGCM-AVKWCDSFSA-N |
| XLogP | 3.45 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile?
The IUPAC name of 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile (CID 90392328) is 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile.
What is the SMILES notation for 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile?
The canonical SMILES for 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile is Cc1ccc(-c2cc([C@@]3(O)CCC(O)C3)nn2-c2ccc(C#N)cc2)cc1.
What is the InChIKey of 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile?
The InChIKey is RMKCXLAPORXGCM-AVKWCDSFSA-N. The full InChI is InChI=1S/C22H21N3O2/c1-15-2-6-17(7-3-15)20-12-21(22(27)11-10-19(26)13-22)24-25(20)18-8-4-16(14-23)5-9-18/h2-9,12,19,26-27H,10-11,13H2,1H3/t19?,22-/m1/s1.
What are the key properties of 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile?
4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile has a molecular weight of 359.43 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[(1R)-1,3-dihydroxycyclopentyl]-5-(4-methylphenyl)pyrazol-1-yl]benzonitrile is sourced from PubChem (CID 90392328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).