C6H12N6O2 — CID 90392503
2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propane-1,3-diol (PubChem CID 90392503) has the molecular formula C6H12N6O2 and a molecular weight of 200.20 g/mol. Its IUPAC name is 2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propane-1,3-diol.
| Compound Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propane-1,3-diol |
|---|---|
| PubChem CID | 90392503 |
| Molecular Formula | C6H12N6O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)amino]propane-1,3-diol |
| SMILES | Nc1nc(N)nc(NC(CO)CO)n1 |
| InChI | InChI=1S/C6H12N6O2/c7-4-10-5(8)12-6(11-4)9-3(1-13)2-14/h3,13-14H,1-2H2,(H5,7,8,9,10,11,12) |
| InChIKey | TYDUJDUZCHMPCA-UHFFFAOYSA-N |
| XLogP | -2.20 |
| TPSA | 143.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |