C26H29F11O — CID 90392779
(5R)-5-[(4S,5E)-3,5-difluoro-7-[(1R,4R)-2-fluoro-4-methylcyclohex-2-en-1-yl]hepta-1,5-dien-4-yl]-2-[difluoro(3,5,5,5-tetrafluoropentoxy)methyl]-1,3-difluorocyclohexa-1,3-diene (PubChem CID 90392779) has the molecular formula C26H29F11O and a molecular weight of 566.50 g/mol. Its IUPAC name is (5R)-5-[(4S,5E)-3,5-difluoro-7-[(1R,4R)-2-fluoro-4-methylcyclohex-2-en-1-yl]hepta-1,5-dien-4-yl]-2-[difluoro(3,5,5,5-tetrafluoropentoxy)methyl]-1,3-difluorocyclohexa-1,3-diene.
| Compound Name | (5R)-5-[(4S,5E)-3,5-difluoro-7-[(1R,4R)-2-fluoro-4-methylcyclohex-2-en-1-yl]hepta-1,5-dien-4-yl]-2-[difluoro(3,5,5,5-tetrafluoropentoxy)methyl]-1,3-difluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 90392779 |
| Molecular Formula | C26H29F11O |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | (5R)-5-[(4S,5E)-3,5-difluoro-7-[(1R,4R)-2-fluoro-4-methylcyclohex-2-en-1-yl]hepta-1,5-dien-4-yl]-2-[difluoro(3,5,5,5-tetrafluoropentoxy)methyl]-1,3-difluorocyclohexa-1,3-diene |
| SMILES | C=CC(F)[C@@H](/C(F)=C\C[C@H]1CC[C@@H](C)C=C1F)[C@H]1C=C(F)C(C(F)(F)OCCC(F)CC(F)(F)F)=C(F)C1 |
| InChI | InChI=1S/C26H29F11O/c1-3-18(28)23(19(29)7-6-15-5-4-14(2)10-20(15)30)16-11-21(31)24(22(32)12-16)26(36,37)38-9-8-17(27)13-25(33,34)35/h3,7,10-11,14-18,23H,1,4-6,8-9,12-13H2,2H3/b19-7+/t14-,15-,16+,17?,18?,23+/m1/s1 |
| InChIKey | KMZQBUVJCDPMFX-KHICOYOISA-N |
| XLogP | 9.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|