C17H7F8N3O2 — CID 90392802
3,4-diamino-1-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]pyrrole-2,5-dione (PubChem CID 90392802) has the molecular formula C17H7F8N3O2 and a molecular weight of 437.25 g/mol. Its IUPAC name is 3,4-diamino-1-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]pyrrole-2,5-dione.
| Compound Name | 3,4-diamino-1-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 90392802 |
| Molecular Formula | C17H7F8N3O2 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | 3,4-diamino-1-[2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)phenyl]pyrrole-2,5-dione |
| SMILES | Cc1c(F)c(F)c(-c2c(F)c(F)c(N3C(=O)C(N)=C(N)C3=O)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C17H7F8N3O2/c1-2-5(18)7(20)3(8(21)6(2)19)4-9(22)11(24)15(12(25)10(4)23)28-16(29)13(26)14(27)17(28)30/h26-27H2,1H3 |
| InChIKey | JBLHNKCIWYVIEI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|