C21H41N3O11P2S — CID 90393228
[(2S)-1-(6-aminohexanoyl)-4-[hydroxy-[[(2S,4R)-4-hydroxy-1-(4-sulfanylbutanoyl)pyrrolidin-2-yl]methoxy]phosphoryl]oxypyrrolidin-2-yl]methyl methyl hydrogen phosphate (PubChem CID 90393228) has the molecular formula C21H41N3O11P2S and a molecular weight of 605.58 g/mol. Its IUPAC name is [(2S)-1-(6-aminohexanoyl)-4-[hydroxy-[[(2S,4R)-4-hydroxy-1-(4-sulfanylbutanoyl)pyrrolidin-2-yl]methoxy]phosphoryl]oxypyrrolidin-2-yl]methyl methyl hydrogen phosphate.
| Compound Name | [(2S)-1-(6-aminohexanoyl)-4-[hydroxy-[[(2S,4R)-4-hydroxy-1-(4-sulfanylbutanoyl)pyrrolidin-2-yl]methoxy]phosphoryl]oxypyrrolidin-2-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 90393228 |
| Molecular Formula | C21H41N3O11P2S |
| Molecular Weight | 605.58 g/mol |
| Exact Mass | 605.19 |
| IUPAC Name | [(2S)-1-(6-aminohexanoyl)-4-[hydroxy-[[(2S,4R)-4-hydroxy-1-(4-sulfanylbutanoyl)pyrrolidin-2-yl]methoxy]phosphoryl]oxypyrrolidin-2-yl]methyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC[C@@H]1CC(OP(=O)(O)OC[C@@H]2C[C@@H](O)CN2C(=O)CCCS)CN1C(=O)CCCCCN |
| InChI | InChI=1S/C21H41N3O11P2S/c1-32-36(28,29)33-15-17-11-19(13-24(17)20(26)6-3-2-4-8-22)35-37(30,31)34-14-16-10-18(25)12-23(16)21(27)7-5-9-38/h16-19,25,38H,2-15,22H2,1H3,(H,28,29)(H,30,31)/t16-,17-,18+,19?/m0/s1 |
| InChIKey | BTIUBFYLKXHPFW-HTUJPFKRSA-N |
| XLogP | 1.04 |
| TPSA | 198.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.58 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|