About N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine
N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 90393366) has the molecular formula C24H22N4OS
and a molecular weight of 414.53 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine |
| PubChem CID | 90393366 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | CCOc1cccc2cc(-c3cnc4ccc(Nc5ccc(C)c(C)c5)nn34)sc12 |
| InChI | InChI=1S/C24H22N4OS/c1-4-29-20-7-5-6-17-13-21(30-24(17)20)19-14-25-23-11-10-22(27-28(19)23)26-18-9-8-15(2)16(3)12-18/h5-14H,4H2,1-3H3,(H,26,27) |
| InChIKey | FVNPQPLPWXXANL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine?
The IUPAC name of N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine (CID 90393366) is N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine.
What is the SMILES notation for N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine?
The canonical SMILES for N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine is CCOc1cccc2cc(-c3cnc4ccc(Nc5ccc(C)c(C)c5)nn34)sc12.
What is the InChIKey of N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine?
The InChIKey is FVNPQPLPWXXANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4OS/c1-4-29-20-7-5-6-17-13-21(30-24(17)20)19-14-25-23-11-10-22(27-28(19)23)26-18-9-8-15(2)16(3)12-18/h5-14H,4H2,1-3H3,(H,26,27).
What are the key properties of N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine?
N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine has a molecular weight of 414.53 g/mol, XLogP of 6.37, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-dimethylphenyl)-3-(7-ethoxy-1-benzothiophen-2-yl)imidazo[1,2-b]pyridazin-6-amine is sourced from PubChem (CID 90393366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).