About N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide
N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide (PubChem CID 90393690) has the molecular formula C20H15F2NO4
and a molecular weight of 371.34 g/mol. Its IUPAC name is N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide.
Molecular Properties
| Compound Name | N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide |
| PubChem CID | 90393690 |
| Molecular Formula | C20H15F2NO4 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide |
| SMILES | Cc1cocc1C(=O)Nc1ccc(-c2cc3c(cc2C)OC(F)(F)O3)cc1 |
| InChI | InChI=1S/C20H15F2NO4/c1-11-7-17-18(27-20(21,22)26-17)8-15(11)13-3-5-14(6-4-13)23-19(24)16-10-25-9-12(16)2/h3-10H,1-2H3,(H,23,24) |
| InChIKey | PDEHFJNIPJKWIT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide?
The IUPAC name of N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide (CID 90393690) is N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide.
What is the SMILES notation for N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide?
The canonical SMILES for N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide is Cc1cocc1C(=O)Nc1ccc(-c2cc3c(cc2C)OC(F)(F)O3)cc1.
What is the InChIKey of N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide?
The InChIKey is PDEHFJNIPJKWIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2NO4/c1-11-7-17-18(27-20(21,22)26-17)8-15(11)13-3-5-14(6-4-13)23-19(24)16-10-25-9-12(16)2/h3-10H,1-2H3,(H,23,24).
What are the key properties of N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide?
N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide has a molecular weight of 371.34 g/mol, XLogP of 5.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)phenyl]-4-methylfuran-3-carboxamide is sourced from PubChem (CID 90393690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).